C22H33F3N2O5 — CID 74968215
2-[4-[[1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]piperazin-1-yl]ethanol (PubChem CID 74968215) has the molecular formula C22H33F3N2O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-[4-[[1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]piperazin-1-yl]ethanol.
| Compound Name | 2-[4-[[1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]piperazin-1-yl]ethanol |
|---|---|
| PubChem CID | 74968215 |
| Molecular Formula | C22H33F3N2O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | 2-[4-[[1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]piperazin-1-yl]ethanol |
| SMILES | CC1CCC2C(CN3CCN(CCO)CC3)=C(C(F)(F)F)OC3OC4(C)CCC1C32OO4 |
| InChI | InChI=1S/C22H33F3N2O5/c1-14-3-4-17-15(13-27-9-7-26(8-10-27)11-12-28)18(22(23,24)25)29-19-21(17)16(14)5-6-20(2,30-19)31-32-21/h14,16-17,19,28H,3-13H2,1-2H3 |
| InChIKey | UXOROFJDMQLTES-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 63.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|