C37H46F6O12 — CID 140555763
bis[[(5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pentanedioate (PubChem CID 140555763) has the molecular formula C37H46F6O12 and a molecular weight of 796.75 g/mol. Its IUPAC name is bis[[(5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pentanedioate.
| Compound Name | bis[[(5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pentanedioate |
|---|---|
| PubChem CID | 140555763 |
| Molecular Formula | C37H46F6O12 |
| Molecular Weight | 796.75 g/mol |
| Exact Mass | 796.29 |
| IUPAC Name | bis[[(5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pentanedioate |
| SMILES | C[C@@H]1CC[C@H]2C(COC(=O)CCCC(=O)OCC3=C(C(F)(F)F)O[C@@H]4OC5(C)CCC6[C@H](C)CC[C@@H]3[C@]64OO5)=C(C(F)(F)F)O[C@@H]3OC4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C37H46F6O12/c1-18-8-10-24-20(28(36(38,39)40)48-30-34(24)22(18)12-14-32(3,50-30)52-54-34)16-46-26(44)6-5-7-27(45)47-17-21-25-11-9-19(2)23-13-15-33(4)51-31(35(23,25)55-53-33)49-29(21)37(41,42)43/h18-19,22-25,30-31H,5-17H2,1-4H3/t18-,19-,22?,23?,24+,25+,30-,31-,32?,33?,34-,35-/m1/s1 |
| InChIKey | LDTXWMPHAPJXJZ-JQXPKGHMSA-N |
| XLogP | 7.37 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.75 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|