C35H43F6NO8 — CID 158424319
N,N-bis[[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]prop-2-yn-1-amine (PubChem CID 158424319) has the molecular formula C35H43F6NO8 and a molecular weight of 719.72 g/mol. Its IUPAC name is N,N-bis[[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]prop-2-yn-1-amine.
| Compound Name | N,N-bis[[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 158424319 |
| Molecular Formula | C35H43F6NO8 |
| Molecular Weight | 719.72 g/mol |
| Exact Mass | 719.29 |
| IUPAC Name | N,N-bis[[(1R,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl]prop-2-yn-1-amine |
| SMILES | C#CCN(CC1=C(C(F)(F)F)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3)CC1=C(C(F)(F)F)O[C@@H]2O[C@@]3(C)CC[C@H]4[C@H](C)CC[C@@H]1[C@@]24OO3 |
| InChI | InChI=1S/C35H43F6NO8/c1-6-15-42(16-20-24-9-7-18(2)22-11-13-30(4)45-28(32(22,24)49-47-30)43-26(20)34(36,37)38)17-21-25-10-8-19(3)23-12-14-31(5)46-29(33(23,25)50-48-31)44-27(21)35(39,40)41/h1,18-19,22-25,28-29H,7-17H2,2-5H3/t18-,19-,22+,23+,24+,25+,28-,29-,30-,31-,32-,33-/m1/s1 |
| InChIKey | RTSYSBWOLPEDPE-DXAWWGBCSA-N |
| XLogP | 7.05 |
| TPSA | 77.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|