C39H43F6NO12 — CID 59539368
bis[[(1S,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pyridine-2,6-dicarboxylate (PubChem CID 59539368) has the molecular formula C39H43F6NO12 and a molecular weight of 831.76 g/mol. Its IUPAC name is bis[[(1S,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pyridine-2,6-dicarboxylate.
| Compound Name | bis[[(1S,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 59539368 |
| Molecular Formula | C39H43F6NO12 |
| Molecular Weight | 831.76 g/mol |
| Exact Mass | 831.27 |
| IUPAC Name | bis[[(1S,4S,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methyl] pyridine-2,6-dicarboxylate |
| SMILES | C[C@@H]1CC[C@H]2C(COC(=O)c3cccc(C(=O)OCC4=C(C(F)(F)F)O[C@@H]5O[C@]6(C)CC[C@H]7[C@H](C)CC[C@@H]4[C@@]57OO6)n3)=C(C(F)(F)F)O[C@@H]3O[C@]4(C)CC[C@@H]1[C@]32OO4 |
| InChI | InChI=1S/C39H43F6NO12/c1-18-8-10-24-20(28(38(40,41)42)51-32-36(24)22(18)12-14-34(3,53-32)55-57-36)16-49-30(47)26-6-5-7-27(46-26)31(48)50-17-21-25-11-9-19(2)23-13-15-35(4)54-33(37(23,25)58-56-35)52-29(21)39(43,44)45/h5-7,18-19,22-25,32-33H,8-17H2,1-4H3/t18-,19-,22+,23+,24+,25+,32-,33-,34+,35+,36-,37-/m1/s1 |
| InChIKey | KWGZZNXGIUGULX-WKLYNBCGSA-N |
| XLogP | 7.52 |
| TPSA | 139.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.76 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|