C38H44O8 — CID 102191093
(2R,3R,4S,5R,6R)-2-(2-methoxypropan-2-ylperoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 102191093) has the molecular formula C38H44O8 and a molecular weight of 628.76 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(2-methoxypropan-2-ylperoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (2R,3R,4S,5R,6R)-2-(2-methoxypropan-2-ylperoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 102191093 |
| Molecular Formula | C38H44O8 |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.30 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(2-methoxypropan-2-ylperoxy)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | COC(C)(C)OO[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C38H44O8/c1-38(2,39-3)46-45-37-36(43-27-32-22-14-7-15-23-32)35(42-26-31-20-12-6-13-21-31)34(41-25-30-18-10-5-11-19-30)33(44-37)28-40-24-29-16-8-4-9-17-29/h4-23,33-37H,24-28H2,1-3H3/t33-,34-,35+,36-,37-/m1/s1 |
| InChIKey | ISQCBEYZRGCENK-KHKVHWIZSA-N |
| XLogP | 7.01 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|