C32H41NSi — CID 102198351
N-[dimethyl-(6,6,9,9-tetramethyl-8,10a-dihydro-7H-benzo[b]fluoren-11-yl)silyl]-2-phenylpropan-2-amine (PubChem CID 102198351) has the molecular formula C32H41NSi and a molecular weight of 467.77 g/mol. Its IUPAC name is N-[dimethyl-(6,6,9,9-tetramethyl-8,10a-dihydro-7H-benzo[b]fluoren-11-yl)silyl]-2-phenylpropan-2-amine.
| Compound Name | N-[dimethyl-(6,6,9,9-tetramethyl-8,10a-dihydro-7H-benzo[b]fluoren-11-yl)silyl]-2-phenylpropan-2-amine |
|---|---|
| PubChem CID | 102198351 |
| Molecular Formula | C32H41NSi |
| Molecular Weight | 467.77 g/mol |
| Exact Mass | 467.30 |
| IUPAC Name | N-[dimethyl-(6,6,9,9-tetramethyl-8,10a-dihydro-7H-benzo[b]fluoren-11-yl)silyl]-2-phenylpropan-2-amine |
| SMILES | CC1(C)CCC(C)(C)C2=CC3C(=c4ccccc4=C3[Si](C)(C)NC(C)(C)c3ccccc3)C=C21 |
| InChI | InChI=1S/C32H41NSi/c1-30(2)18-19-31(3,4)28-21-26-25(20-27(28)30)23-16-12-13-17-24(23)29(26)34(7,8)33-32(5,6)22-14-10-9-11-15-22/h9-17,20-21,26,33H,18-19H2,1-8H3 |
| InChIKey | MOGWFLRIEZZSEM-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.77 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|