C30H45NSi — CID 162287063
2-methyl-N-[(2,4,4,7,7-pentamethyl-2,3,3a,5,6,7a-hexahydro-1H-inden-1-yl)-diphenylsilyl]propan-2-amine (PubChem CID 162287063) has the molecular formula C30H45NSi and a molecular weight of 447.78 g/mol. Its IUPAC name is 2-methyl-N-[(2,4,4,7,7-pentamethyl-2,3,3a,5,6,7a-hexahydro-1H-inden-1-yl)-diphenylsilyl]propan-2-amine.
| Compound Name | 2-methyl-N-[(2,4,4,7,7-pentamethyl-2,3,3a,5,6,7a-hexahydro-1H-inden-1-yl)-diphenylsilyl]propan-2-amine |
|---|---|
| PubChem CID | 162287063 |
| Molecular Formula | C30H45NSi |
| Molecular Weight | 447.78 g/mol |
| Exact Mass | 447.33 |
| IUPAC Name | 2-methyl-N-[(2,4,4,7,7-pentamethyl-2,3,3a,5,6,7a-hexahydro-1H-inden-1-yl)-diphenylsilyl]propan-2-amine |
| SMILES | CC1CC2C(C1[Si](NC(C)(C)C)(c1ccccc1)c1ccccc1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C30H45NSi/c1-22-21-25-26(30(7,8)20-19-29(25,5)6)27(22)32(31-28(2,3)4,23-15-11-9-12-16-23)24-17-13-10-14-18-24/h9-18,22,25-27,31H,19-21H2,1-8H3 |
| InChIKey | GTQDXFBHSHYCES-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|