C34H47NSi — CID 140878838
2-methyl-N-[(2,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalen-3-yl)-diphenylsilyl]propan-2-amine (PubChem CID 140878838) has the molecular formula C34H47NSi and a molecular weight of 497.84 g/mol. Its IUPAC name is 2-methyl-N-[(2,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalen-3-yl)-diphenylsilyl]propan-2-amine.
| Compound Name | 2-methyl-N-[(2,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalen-3-yl)-diphenylsilyl]propan-2-amine |
|---|---|
| PubChem CID | 140878838 |
| Molecular Formula | C34H47NSi |
| Molecular Weight | 497.84 g/mol |
| Exact Mass | 497.35 |
| IUPAC Name | 2-methyl-N-[(2,5,5,8,8-pentamethyl-2,3,3a,6,7,9a-hexahydro-1H-cyclopenta[b]naphthalen-3-yl)-diphenylsilyl]propan-2-amine |
| SMILES | CC1CC2C=C3C(=CC2C1[Si](NC(C)(C)C)(c1ccccc1)c1ccccc1)C(C)(C)CCC3(C)C |
| InChI | InChI=1S/C34H47NSi/c1-24-21-25-22-29-30(34(7,8)20-19-33(29,5)6)23-28(25)31(24)36(35-32(2,3)4,26-15-11-9-12-16-26)27-17-13-10-14-18-27/h9-18,22-25,28,31,35H,19-21H2,1-8H3 |
| InChIKey | OZXGPXXNLUXMTM-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.84 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|