C30H42O3Si — CID 102053083
(1R,3aS,6R,7S,7aR)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,3,3,6-tetramethyl-2,3a,5,6,7,7a-hexahydroinden-4-one (PubChem CID 102053083) has the molecular formula C30H42O3Si and a molecular weight of 478.75 g/mol. Its IUPAC name is (1R,3aS,6R,7S,7aR)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,3,3,6-tetramethyl-2,3a,5,6,7,7a-hexahydroinden-4-one.
| Compound Name | (1R,3aS,6R,7S,7aR)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,3,3,6-tetramethyl-2,3a,5,6,7,7a-hexahydroinden-4-one |
|---|---|
| PubChem CID | 102053083 |
| Molecular Formula | C30H42O3Si |
| Molecular Weight | 478.75 g/mol |
| Exact Mass | 478.29 |
| IUPAC Name | (1R,3aS,6R,7S,7aR)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]-1-hydroxy-1,3,3,6-tetramethyl-2,3a,5,6,7,7a-hexahydroinden-4-one |
| SMILES | C[C@@H]1CC(=O)[C@H]2[C@@H]([C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@](C)(O)CC2(C)C |
| InChI | InChI=1S/C30H42O3Si/c1-21-18-25(31)27-26(30(7,32)20-29(27,5)6)24(21)19-33-34(28(2,3)4,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,21,24,26-27,32H,18-20H2,1-7H3/t21-,24+,26-,27+,30-/m1/s1 |
| InChIKey | BHJVDHSRKHRAJN-LURRUMJDSA-N |
| XLogP | 5.20 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.75 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|