C26H26N2O3 — CID 102198654
[(1S,2R,10S,19S)-12,14-dimethoxy-9,17-diazahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-3,5,7,11(16),12,14,20,22,24-nonaen-19-yl]methanol (PubChem CID 102198654) has the molecular formula C26H26N2O3 and a molecular weight of 414.51 g/mol. Its IUPAC name is [(1S,2R,10S,19S)-12,14-dimethoxy-9,17-diazahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-3,5,7,11(16),12,14,20,22,24-nonaen-19-yl]methanol.
| Compound Name | [(1S,2R,10S,19S)-12,14-dimethoxy-9,17-diazahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-3,5,7,11(16),12,14,20,22,24-nonaen-19-yl]methanol |
|---|---|
| PubChem CID | 102198654 |
| Molecular Formula | C26H26N2O3 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | [(1S,2R,10S,19S)-12,14-dimethoxy-9,17-diazahexacyclo[15.8.0.02,10.03,8.011,16.020,25]pentacosa-3,5,7,11(16),12,14,20,22,24-nonaen-19-yl]methanol |
| SMILES | COc1cc(OC)c2c(c1)N1C[C@@H](CO)c3ccccc3[C@@H]1[C@@H]1c3ccccc3N[C@H]21 |
| InChI | InChI=1S/C26H26N2O3/c1-30-16-11-21-24(22(12-16)31-2)25-23(19-9-5-6-10-20(19)27-25)26-18-8-4-3-7-17(18)15(14-29)13-28(21)26/h3-12,15,23,25-27,29H,13-14H2,1-2H3/t15-,23+,25-,26+/m0/s1 |
| InChIKey | DZRMRIMRGDHGEY-HPCWBVNOSA-N |
| XLogP | 4.61 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |