C7H7NOS4 — CID 102199019
5-(1,3-dithiolan-2-ylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 102199019) has the molecular formula C7H7NOS4 and a molecular weight of 249.41 g/mol. Its IUPAC name is 5-(1,3-dithiolan-2-ylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 5-(1,3-dithiolan-2-ylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 102199019 |
| Molecular Formula | C7H7NOS4 |
| Molecular Weight | 249.41 g/mol |
| Exact Mass | 248.94 |
| IUPAC Name | 5-(1,3-dithiolan-2-ylidene)-3-methyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CN1C(=O)C(=C2SCCS2)SC1=S |
| InChI | InChI=1S/C7H7NOS4/c1-8-5(9)4(13-7(8)10)6-11-2-3-12-6/h2-3H2,1H3 |
| InChIKey | UBAGGCQWEITNSF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.41 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|