C7H8O26P7-13 — CID 102201018
[(2R,3S,5R,6S)-2,3,4,5,6-pentaphosphonatooxycyclohexyl]oxy-(phosphonatomethyl)phosphinate (PubChem CID 102201018) has the molecular formula C7H8O26P7-13 and a molecular weight of 724.93 g/mol. Its IUPAC name is [(2R,3S,5R,6S)-2,3,4,5,6-pentaphosphonatooxycyclohexyl]oxy-(phosphonatomethyl)phosphinate.
| Compound Name | [(2R,3S,5R,6S)-2,3,4,5,6-pentaphosphonatooxycyclohexyl]oxy-(phosphonatomethyl)phosphinate |
|---|---|
| PubChem CID | 102201018 |
| Molecular Formula | C7H8O26P7-13 |
| Molecular Weight | 724.93 g/mol |
| Exact Mass | 724.75 |
| IUPAC Name | [(2R,3S,5R,6S)-2,3,4,5,6-pentaphosphonatooxycyclohexyl]oxy-(phosphonatomethyl)phosphinate |
| SMILES | O=P([O-])([O-])OC1[C@@H](OP(=O)([O-])[O-])[C@H](OP(=O)([O-])[O-])C(OP(=O)([O-])C[P+]([O-])([O-])[O-])[C@H](OP(=O)([O-])[O-])[C@H]1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C7H21O26P7/c8-34(9,10)1-35(11,12)28-2-3(29-36(13,14)15)5(31-38(19,20)21)7(33-40(25,26)27)6(32-39(22,23)24)4(2)30-37(16,17)18/h2-7H,1H2,(H,11,12)(H2,8,9,10)(H2,13,14,15)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)(H2,25,26,27)/p-13/t2?,3-,4+,5+,6-,7? |
| InChIKey | IZNCMXVIYGYGJI-MVWKSXLKSA-A |
| XLogP | -12.19 |
| TPSA | 480.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 26 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.93 |
| LogP ≤ 5 | -12.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 26 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|