C13H26N2+2 — CID 102201326
trimethyl-[[2-[(trimethylazaniumyl)methyl]cyclopenta-1,3-dien-1-yl]methyl]azanium (PubChem CID 102201326) has the molecular formula C13H26N2+2 and a molecular weight of 210.36 g/mol. Its IUPAC name is trimethyl-[[2-[(trimethylazaniumyl)methyl]cyclopenta-1,3-dien-1-yl]methyl]azanium.
| Compound Name | trimethyl-[[2-[(trimethylazaniumyl)methyl]cyclopenta-1,3-dien-1-yl]methyl]azanium |
|---|---|
| PubChem CID | 102201326 |
| Molecular Formula | C13H26N2+2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | trimethyl-[[2-[(trimethylazaniumyl)methyl]cyclopenta-1,3-dien-1-yl]methyl]azanium |
| SMILES | C[N+](C)(C)CC1=C(C[N+](C)(C)C)CC=C1 |
| InChI | InChI=1S/C13H26N2/c1-14(2,3)10-12-8-7-9-13(12)11-15(4,5)6/h7-8H,9-11H2,1-6H3/q+2 |
| InChIKey | PRRODDPOBYHYTC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|