C17H13NO5 — CID 102203297
ethyl 13,15-dioxo-14-oxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-1(16),2,4,6,11-pentaene-11-carboxylate (PubChem CID 102203297) has the molecular formula C17H13NO5 and a molecular weight of 311.29 g/mol. Its IUPAC name is ethyl 13,15-dioxo-14-oxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-1(16),2,4,6,11-pentaene-11-carboxylate.
| Compound Name | ethyl 13,15-dioxo-14-oxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-1(16),2,4,6,11-pentaene-11-carboxylate |
|---|---|
| PubChem CID | 102203297 |
| Molecular Formula | C17H13NO5 |
| Molecular Weight | 311.29 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl 13,15-dioxo-14-oxa-10-azatetracyclo[8.6.0.02,7.012,16]hexadeca-1(16),2,4,6,11-pentaene-11-carboxylate |
| SMILES | CCOC(=O)c1c2c(c3n1CCc1ccccc1-3)C(=O)OC2=O |
| InChI | InChI=1S/C17H13NO5/c1-2-22-17(21)14-12-11(15(19)23-16(12)20)13-10-6-4-3-5-9(10)7-8-18(13)14/h3-6H,2,7-8H2,1H3 |
| InChIKey | JGMWCDCRYPETCF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|