C23H18N2O4 — CID 20855117
ethyl 2-(12,14-dioxo-10-phenyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(15),2,4,6,10-pentaen-13-yl)acetate (PubChem CID 20855117) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is ethyl 2-(12,14-dioxo-10-phenyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(15),2,4,6,10-pentaen-13-yl)acetate.
| Compound Name | ethyl 2-(12,14-dioxo-10-phenyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(15),2,4,6,10-pentaen-13-yl)acetate |
|---|---|
| PubChem CID | 20855117 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | ethyl 2-(12,14-dioxo-10-phenyl-9,13-diazatetracyclo[7.6.0.02,7.011,15]pentadeca-1(15),2,4,6,10-pentaen-13-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)c2c(c3n(c2-c2ccccc2)Cc2ccccc2-3)C1=O |
| InChI | InChI=1S/C23H18N2O4/c1-2-29-17(26)13-25-22(27)18-19(23(25)28)21-16-11-7-6-10-15(16)12-24(21)20(18)14-8-4-3-5-9-14/h3-11H,2,12-13H2,1H3 |
| InChIKey | LGMCCXRXVJPWTE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|