C25H24BF2N3 — CID 102209451
[4-(2,2-difluoro-4,6,10-trimethyl-12-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]methanamine (PubChem CID 102209451) has the molecular formula C25H24BF2N3 and a molecular weight of 415.30 g/mol. Its IUPAC name is [4-(2,2-difluoro-4,6,10-trimethyl-12-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]methanamine.
| Compound Name | [4-(2,2-difluoro-4,6,10-trimethyl-12-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 102209451 |
| Molecular Formula | C25H24BF2N3 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | [4-(2,2-difluoro-4,6,10-trimethyl-12-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenyl]methanamine |
| SMILES | CC1=CC(c2ccccc2)=[N+]2C1=C(c1ccc(CN)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C25H24BF2N3/c1-16-13-18(3)30-24(16)23(21-11-9-19(15-29)10-12-21)25-17(2)14-22(31(25)26(30,27)28)20-7-5-4-6-8-20/h4-14H,15,29H2,1-3H3 |
| InChIKey | JFPKUVKPSKVPOW-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 33.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|