C19H18BF2N3S — CID 144835610
2,2-difluoro-4,6,10,12-tetramethyl-8-(4-thionitrosophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 144835610) has the molecular formula C19H18BF2N3S and a molecular weight of 369.25 g/mol. Its IUPAC name is 2,2-difluoro-4,6,10,12-tetramethyl-8-(4-thionitrosophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-(4-thionitrosophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 144835610 |
| Molecular Formula | C19H18BF2N3S |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2,2-difluoro-4,6,10,12-tetramethyl-8-(4-thionitrosophenyl)-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | CC1=CC(C)=[N+]2C1=C(c1ccc(N=S)cc1)c1c(C)cc(C)n1[B-]2(F)F |
| InChI | InChI=1S/C19H18BF2N3S/c1-11-9-13(3)24-18(11)17(15-5-7-16(23-26)8-6-15)19-12(2)10-14(4)25(19)20(24,21)22/h5-10H,1-4H3 |
| InChIKey | SSIMAADUYFSHFA-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|