C20H23NO2 — CID 102211482
tert-butyl N-[(Z)-1,3-diphenylprop-1-en-2-yl]carbamate (PubChem CID 102211482) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl N-[(Z)-1,3-diphenylprop-1-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(Z)-1,3-diphenylprop-1-en-2-yl]carbamate |
|---|---|
| PubChem CID | 102211482 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | tert-butyl N-[(Z)-1,3-diphenylprop-1-en-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N/C(=C\c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c1-20(2,3)23-19(22)21-18(14-16-10-6-4-7-11-16)15-17-12-8-5-9-13-17/h4-14H,15H2,1-3H3,(H,21,22)/b18-14- |
| InChIKey | MYYDOCZIIROURN-JXAWBTAJSA-N |
| XLogP | 4.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |