About N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline
N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline (PubChem CID 23278560) has the molecular formula C21H19N
and a molecular weight of 285.39 g/mol. Its IUPAC name is N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline.
Molecular Properties
| Compound Name | N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline |
| PubChem CID | 23278560 |
| Molecular Formula | C21H19N |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline |
| SMILES | C(=C(\Cc1ccccc1)Nc1ccccc1)\c1ccccc1 |
| InChI | InChI=1S/C21H19N/c1-4-10-18(11-5-1)16-21(17-19-12-6-2-7-13-19)22-20-14-8-3-9-15-20/h1-16,22H,17H2/b21-16+ |
| InChIKey | BEERTDFBSFZHMA-LTGZKZEYSA-N |
| XLogP | 5.38 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline?
The IUPAC name of N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline (CID 23278560) is N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline.
What is the SMILES notation for N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline?
The canonical SMILES for N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline is C(=C(\Cc1ccccc1)Nc1ccccc1)\c1ccccc1.
What is the InChIKey of N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline?
The InChIKey is BEERTDFBSFZHMA-LTGZKZEYSA-N. The full InChI is InChI=1S/C21H19N/c1-4-10-18(11-5-1)16-21(17-19-12-6-2-7-13-19)22-20-14-8-3-9-15-20/h1-16,22H,17H2/b21-16+.
What are the key properties of N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline?
N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline has a molecular weight of 285.39 g/mol, XLogP of 5.38, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1,3-diphenylprop-1-en-2-yl]aniline is sourced from PubChem (CID 23278560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).