C30H70O7Si6 — CID 102215529
1,3,3,5,5,7,9,9,11,11-deca(propan-2-yl)-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane (PubChem CID 102215529) has the molecular formula C30H70O7Si6 and a molecular weight of 711.40 g/mol. Its IUPAC name is 1,3,3,5,5,7,9,9,11,11-deca(propan-2-yl)-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane.
| Compound Name | 1,3,3,5,5,7,9,9,11,11-deca(propan-2-yl)-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
|---|---|
| PubChem CID | 102215529 |
| Molecular Formula | C30H70O7Si6 |
| Molecular Weight | 711.40 g/mol |
| Exact Mass | 710.37 |
| IUPAC Name | 1,3,3,5,5,7,9,9,11,11-deca(propan-2-yl)-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecane |
| SMILES | CC(C)[Si]12O[Si](C(C)C)(O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O1)O[Si](C(C)C)(C(C)C)O[Si](C(C)C)(C(C)C)O2 |
| InChI | InChI=1S/C30H70O7Si6/c1-21(2)38(22(3)4)31-39(23(5)6,24(7)8)34-43(30(19)20)36-41(27(13)14,28(15)16)32-40(25(9)10,26(11)12)35-42(33-38,37-43)29(17)18/h21-30H,1-20H3 |
| InChIKey | VGHJNONYNLTCIX-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.40 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|