C15H16N4 — CID 102215677
4-[diazo-(2,6-dimethyl-4-pyridinyl)methyl]-2,6-dimethylpyridine (PubChem CID 102215677) has the molecular formula C15H16N4 and a molecular weight of 252.32 g/mol. Its IUPAC name is 4-[diazo-(2,6-dimethyl-4-pyridinyl)methyl]-2,6-dimethylpyridine.
| Compound Name | 4-[diazo-(2,6-dimethyl-4-pyridinyl)methyl]-2,6-dimethylpyridine |
|---|---|
| PubChem CID | 102215677 |
| Molecular Formula | C15H16N4 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 4-[diazo-(2,6-dimethyl-4-pyridinyl)methyl]-2,6-dimethylpyridine |
| SMILES | Cc1cc(C(=[N+]=[N-])c2cc(C)nc(C)c2)cc(C)n1 |
| InChI | InChI=1S/C15H16N4/c1-9-5-13(6-10(2)17-9)15(19-16)14-7-11(3)18-12(4)8-14/h5-8H,1-4H3 |
| InChIKey | KFHGZAAUGOKQOI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 62.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|