C54H75N3O7S — CID 102217919
1-[4-(3,6,7,10,11-pentapentoxytriphenylen-2-yl)oxybutanoylamino]-3-phenylthiourea (PubChem CID 102217919) has the molecular formula C54H75N3O7S and a molecular weight of 910.27 g/mol. Its IUPAC name is 1-[4-(3,6,7,10,11-pentapentoxytriphenylen-2-yl)oxybutanoylamino]-3-phenylthiourea.
| Compound Name | 1-[4-(3,6,7,10,11-pentapentoxytriphenylen-2-yl)oxybutanoylamino]-3-phenylthiourea |
|---|---|
| PubChem CID | 102217919 |
| Molecular Formula | C54H75N3O7S |
| Molecular Weight | 910.27 g/mol |
| Exact Mass | 909.53 |
| IUPAC Name | 1-[4-(3,6,7,10,11-pentapentoxytriphenylen-2-yl)oxybutanoylamino]-3-phenylthiourea |
| SMILES | CCCCCOc1cc2c3cc(OCCCCC)c(OCCCCC)cc3c3cc(OCCCC(=O)NNC(=S)Nc4ccccc4)c(OCCCCC)cc3c2cc1OCCCCC |
| InChI | InChI=1S/C54H75N3O7S/c1-6-11-19-28-59-47-34-41-42-35-48(60-29-20-12-7-2)50(62-31-22-14-9-4)37-44(42)46-39-52(64-33-24-27-53(58)56-57-54(65)55-40-25-17-16-18-26-40)51(63-32-23-15-10-5)38-45(46)43(41)36-49(47)61-30-21-13-8-3/h16-18,25-26,34-39H,6-15,19-24,27-33H2,1-5H3,(H,56,58)(H2,55,57,65) |
| InChIKey | UKYHORLLHAJFPZ-UHFFFAOYSA-N |
| XLogP | 14.17 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 910.27 |
| LogP ≤ 5 | 14.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|