C21H31N3O2S — CID 10221943
cis-(1R,2R)-N-(cyanomethyl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide (PubChem CID 10221943) has the molecular formula C21H31N3O2S and a molecular weight of 389.57 g/mol. Its IUPAC name is cis-(1R,2R)-N-(cyanomethyl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-(cyanomethyl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 10221943 |
| Molecular Formula | C21H31N3O2S |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | cis-(1R,2R)-N-(cyanomethyl)-2-[[4-[3-(dimethylamino)propoxy]phenyl]sulfanylmethyl]cyclohexane-1-carboxamide |
| SMILES | CN(C)CCCOc1ccc(SC[C@@H]2CCCC[C@H]2C(=O)NCC#N)cc1 |
| InChI | InChI=1S/C21H31N3O2S/c1-24(2)14-5-15-26-18-8-10-19(11-9-18)27-16-17-6-3-4-7-20(17)21(25)23-13-12-22/h8-11,17,20H,3-7,13-16H2,1-2H3,(H,23,25)/t17-,20+/m0/s1 |
| InChIKey | YJHODLFRJDHMHF-FXAWDEMLSA-N |
| XLogP | 3.56 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|