About ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate
ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate (PubChem CID 102220205) has the molecular formula C16H32O9P2
and a molecular weight of 430.37 g/mol. Its IUPAC name is ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate.
Molecular Properties
| Compound Name | ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate |
| PubChem CID | 102220205 |
| Molecular Formula | C16H32O9P2 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate |
| SMILES | C=C(COC(C)(P(=O)(OCC)OCC)P(=O)(OCC)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H32O9P2/c1-8-20-15(17)14(6)13-21-16(7,26(18,22-9-2)23-10-3)27(19,24-11-4)25-12-5/h6,8-13H2,1-5,7H3 |
| InChIKey | SBHDHMLHBVRSRP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate?
The IUPAC name of ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate (CID 102220205) is ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate.
What is the SMILES notation for ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate?
The canonical SMILES for ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate is C=C(COC(C)(P(=O)(OCC)OCC)P(=O)(OCC)OCC)C(=O)OCC.
What is the InChIKey of ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate?
The InChIKey is SBHDHMLHBVRSRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O9P2/c1-8-20-15(17)14(6)13-21-16(7,26(18,22-9-2)23-10-3)27(19,24-11-4)25-12-5/h6,8-13H2,1-5,7H3.
What are the key properties of ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate?
ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate has a molecular weight of 430.37 g/mol, XLogP of 4.33, 15 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate is sourced from PubChem (CID 102220205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).