C16H32O9P2 — CID 102220205
ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate (PubChem CID 102220205) has the molecular formula C16H32O9P2 and a molecular weight of 430.37 g/mol. Its IUPAC name is ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate.
| Compound Name | ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate |
|---|---|
| PubChem CID | 102220205 |
| Molecular Formula | C16H32O9P2 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | ethyl 2-[1,1-bis(diethoxyphosphoryl)ethoxymethyl]prop-2-enoate |
| SMILES | C=C(COC(C)(P(=O)(OCC)OCC)P(=O)(OCC)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H32O9P2/c1-8-20-15(17)14(6)13-21-16(7,26(18,22-9-2)23-10-3)27(19,24-11-4)25-12-5/h6,8-13H2,1-5,7H3 |
| InChIKey | SBHDHMLHBVRSRP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|