C15H10N4OSe — CID 102220693
3-selena-4,5,13-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene-13-carboxamide (PubChem CID 102220693) has the molecular formula C15H10N4OSe and a molecular weight of 341.23 g/mol. Its IUPAC name is 3-selena-4,5,13-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene-13-carboxamide.
| Compound Name | 3-selena-4,5,13-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene-13-carboxamide |
|---|---|
| PubChem CID | 102220693 |
| Molecular Formula | C15H10N4OSe |
| Molecular Weight | 341.23 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 3-selena-4,5,13-triazatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),4,7,9,11,14,16-octaene-13-carboxamide |
| SMILES | NC(=O)N1c2ccccc2-c2nn[se]c2-c2ccccc21 |
| InChI | InChI=1S/C15H10N4OSe/c16-15(20)19-11-7-3-1-5-9(11)13-14(21-18-17-13)10-6-2-4-8-12(10)19/h1-8H,(H2,16,20) |
| InChIKey | ZQDPTLCYKARBCA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|