C40H36FNO3S — CID 102223187
CID 102223187 (PubChem CID 102223187) has the molecular formula C40H36FNO3S and a molecular weight of 629.80 g/mol.
| Compound Name | CID 102223187 |
|---|---|
| PubChem CID | 102223187 |
| Molecular Formula | C40H36FNO3S |
| Molecular Weight | 629.80 g/mol |
| Exact Mass | 629.24 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1C[C@@]1(C2=O)[C@@H](c2ccccc2F)C2CSCN2[C@@]12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C40H36FNO3S/c1-38-17-16-26-25-15-13-24(43)18-23(25)12-14-27(26)31(38)19-39(37(38)45)35(28-8-2-3-11-32(28)41)33-20-46-21-42(33)40(39)30-10-5-7-22-6-4-9-29(34(22)30)36(40)44/h2-11,13,15,18,26-27,31,33,35,43H,12,14,16-17,19-21H2,1H3/t26-,27-,31+,33?,35+,38+,39+,40+/m1/s1 |
| InChIKey | OLHBZFYHBJDKRA-ZHYALUAFSA-N |
| XLogP | 7.97 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.80 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |