C42H38ClN3O2 — CID 132555016
CID 132555016 (PubChem CID 132555016) has the molecular formula C42H38ClN3O2 and a molecular weight of 652.24 g/mol.
| Compound Name | CID 132555016 |
|---|---|
| PubChem CID | 132555016 |
| Molecular Formula | C42H38ClN3O2 |
| Molecular Weight | 652.24 g/mol |
| Exact Mass | 651.27 |
| IUPAC Name | — |
| SMILES | CN1C[C@H](c2ccc(Cl)cc2)[C@@]2(C[C@H]3[C@@H]4CCc5cc(O)ccc5[C@H]4CC[C@]3(C)C2=O)[C@]12c1ccccc1-c1nc3ccccc3nc12 |
| InChI | InChI=1S/C42H38ClN3O2/c1-40-20-19-29-28-18-16-27(47)21-25(28)13-17-30(29)33(40)22-41(39(40)48)34(24-11-14-26(43)15-12-24)23-46(2)42(41)32-8-4-3-7-31(32)37-38(42)45-36-10-6-5-9-35(36)44-37/h3-12,14-16,18,21,29-30,33-34,47H,13,17,19-20,22-23H2,1-2H3/t29-,30-,33+,34-,40+,41-,42-/m1/s1 |
| InChIKey | LWPPMELNIKKUET-VXPWEKEHSA-N |
| XLogP | 8.66 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.24 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |