C9H8N4O — CID 102225006
6-methoxy-9-propa-1,2-dienylpurine (PubChem CID 102225006) has the molecular formula C9H8N4O and a molecular weight of 188.19 g/mol. Its IUPAC name is 6-methoxy-9-propa-1,2-dienylpurine.
| Compound Name | 6-methoxy-9-propa-1,2-dienylpurine |
|---|---|
| PubChem CID | 102225006 |
| Molecular Formula | C9H8N4O |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 6-methoxy-9-propa-1,2-dienylpurine |
| SMILES | C=C=Cn1cnc2c(OC)ncnc21 |
| InChI | InChI=1S/C9H8N4O/c1-3-4-13-6-12-7-8(13)10-5-11-9(7)14-2/h4-6H,1H2,2H3 |
| InChIKey | MXRILRYJGMLZGH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |