C23H18N4O5S — CID 102227397
(6R,7S)-6,7-bis(4-nitrophenyl)-3-phenyl-2-sulfanylidene-1,3-diazepan-4-one (PubChem CID 102227397) has the molecular formula C23H18N4O5S and a molecular weight of 462.49 g/mol. Its IUPAC name is (6R,7S)-6,7-bis(4-nitrophenyl)-3-phenyl-2-sulfanylidene-1,3-diazepan-4-one.
| Compound Name | (6R,7S)-6,7-bis(4-nitrophenyl)-3-phenyl-2-sulfanylidene-1,3-diazepan-4-one |
|---|---|
| PubChem CID | 102227397 |
| Molecular Formula | C23H18N4O5S |
| Molecular Weight | 462.49 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | (6R,7S)-6,7-bis(4-nitrophenyl)-3-phenyl-2-sulfanylidene-1,3-diazepan-4-one |
| SMILES | O=C1C[C@H](c2ccc([N+](=O)[O-])cc2)[C@@H](c2ccc([N+](=O)[O-])cc2)NC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C23H18N4O5S/c28-21-14-20(15-6-10-18(11-7-15)26(29)30)22(16-8-12-19(13-9-16)27(31)32)24-23(33)25(21)17-4-2-1-3-5-17/h1-13,20,22H,14H2,(H,24,33)/t20-,22-/m1/s1 |
| InChIKey | GQFRPSDDEFUDGU-IFMALSPDSA-N |
| XLogP | 4.64 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|