C30H22N4O2 — CID 102227844
2-[2,7-bis(4-methoxyanilino)fluoren-9-ylidene]propanedinitrile (PubChem CID 102227844) has the molecular formula C30H22N4O2 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[2,7-bis(4-methoxyanilino)fluoren-9-ylidene]propanedinitrile.
| Compound Name | 2-[2,7-bis(4-methoxyanilino)fluoren-9-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 102227844 |
| Molecular Formula | C30H22N4O2 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 2-[2,7-bis(4-methoxyanilino)fluoren-9-ylidene]propanedinitrile |
| SMILES | COc1ccc(Nc2ccc3c(c2)C(=C(C#N)C#N)c2cc(Nc4ccc(OC)cc4)ccc2-3)cc1 |
| InChI | InChI=1S/C30H22N4O2/c1-35-24-9-3-20(4-10-24)33-22-7-13-26-27-14-8-23(34-21-5-11-25(36-2)12-6-21)16-29(27)30(28(26)15-22)19(17-31)18-32/h3-16,33-34H,1-2H3 |
| InChIKey | IZBIDNQTOBEVNN-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 90.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|