C14H8Br2N2 — CID 102228628
2,8-dibromobenzo[c][1,5]benzodiazocine (PubChem CID 102228628) has the molecular formula C14H8Br2N2 and a molecular weight of 364.04 g/mol. Its IUPAC name is 2,8-dibromobenzo[c][1,5]benzodiazocine.
| Compound Name | 2,8-dibromobenzo[c][1,5]benzodiazocine |
|---|---|
| PubChem CID | 102228628 |
| Molecular Formula | C14H8Br2N2 |
| Molecular Weight | 364.04 g/mol |
| Exact Mass | 361.91 |
| IUPAC Name | 2,8-dibromobenzo[c][1,5]benzodiazocine |
| SMILES | Brc1cc/c2c(c1)=C/N=c1/ccc(Br)cc1=C/N=2 |
| InChI | InChI=1S/C14H8Br2N2/c15-11-1-3-13-9(5-11)7-18-14-4-2-12(16)6-10(14)8-17-13/h1-8H/b9-7?,10-8?,17-8?,17-13-,18-7?,18-14- |
| InChIKey | XJGPSHJOHQHABZ-GVPPPSKTSA-N |
| XLogP | 1.64 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.04 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |