C18H23NO6 — CID 102229696
2-O-methyl 4-O-phenyl 5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-2,4-dicarboxylate (PubChem CID 102229696) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is 2-O-methyl 4-O-phenyl 5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-2,4-dicarboxylate.
| Compound Name | 2-O-methyl 4-O-phenyl 5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-2,4-dicarboxylate |
|---|---|
| PubChem CID | 102229696 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 2-O-methyl 4-O-phenyl 5-(2,2-dimethyl-1,3-dioxolan-4-yl)pyrrolidine-2,4-dicarboxylate |
| SMILES | COC(=O)C1CC(C(=O)Oc2ccccc2)C(C2COC(C)(C)O2)N1 |
| InChI | InChI=1S/C18H23NO6/c1-18(2)23-10-14(25-18)15-12(9-13(19-15)17(21)22-3)16(20)24-11-7-5-4-6-8-11/h4-8,12-15,19H,9-10H2,1-3H3 |
| InChIKey | JGSZQQHRVUZGSI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|