C19H23NO4S2 — CID 102230119
ethyl 5-[1,1-bis(ethylsulfanyl)-3-oxo-3-phenylprop-1-en-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 102230119) has the molecular formula C19H23NO4S2 and a molecular weight of 393.53 g/mol. Its IUPAC name is ethyl 5-[1,1-bis(ethylsulfanyl)-3-oxo-3-phenylprop-1-en-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[1,1-bis(ethylsulfanyl)-3-oxo-3-phenylprop-1-en-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102230119 |
| Molecular Formula | C19H23NO4S2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | ethyl 5-[1,1-bis(ethylsulfanyl)-3-oxo-3-phenylprop-1-en-2-yl]-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)C1N=COC1C(C(=O)c1ccccc1)=C(SCC)SCC |
| InChI | InChI=1S/C19H23NO4S2/c1-4-23-18(22)15-17(24-12-20-15)14(19(25-5-2)26-6-3)16(21)13-10-8-7-9-11-13/h7-12,15,17H,4-6H2,1-3H3 |
| InChIKey | LRLLIDFTTXMIIX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|