About ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate
ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 15501178) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
Analyze ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The IUPAC name of ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate (CID 15501178) is ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The canonical SMILES for ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate is CCOC(=O)C1N=COC1C(C)(C)C.
What is the InChIKey of ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
The InChIKey is FWXWBCPXNJRAOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-5-13-9(12)7-8(10(2,3)4)14-6-11-7/h6-8H,5H2,1-4H3.
What are the key properties of ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate?
ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate has a molecular weight of 199.25 g/mol, XLogP of 1.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-tert-butyl-4,5-dihydro-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 15501178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).