C11H9Cl3N2O3 — CID 125458772
ethyl (4R,5R)-5-(2,4,6-trichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate (PubChem CID 125458772) has the molecular formula C11H9Cl3N2O3 and a molecular weight of 323.56 g/mol. Its IUPAC name is ethyl (4R,5R)-5-(2,4,6-trichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl (4R,5R)-5-(2,4,6-trichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 125458772 |
| Molecular Formula | C11H9Cl3N2O3 |
| Molecular Weight | 323.56 g/mol |
| Exact Mass | 321.97 |
| IUPAC Name | ethyl (4R,5R)-5-(2,4,6-trichloro-3-pyridinyl)-4,5-dihydro-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)[C@@H]1N=CO[C@@H]1c1c(Cl)cc(Cl)nc1Cl |
| InChI | InChI=1S/C11H9Cl3N2O3/c1-2-18-11(17)8-9(19-4-15-8)7-5(12)3-6(13)16-10(7)14/h3-4,8-9H,2H2,1H3/t8-,9-/m1/s1 |
| InChIKey | WROSHCCHCFBACB-RKDXNWHRSA-N |
| XLogP | 3.07 |
| TPSA | 60.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.56 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|