C14H13BClF2N3O — CID 102231727
4-[(Z)-2-(6-chloropyrimidin-4-yl)-1-difluoroboranyloxyethenyl]-N,N-dimethylaniline (PubChem CID 102231727) has the molecular formula C14H13BClF2N3O and a molecular weight of 323.54 g/mol. Its IUPAC name is 4-[(Z)-2-(6-chloropyrimidin-4-yl)-1-difluoroboranyloxyethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[(Z)-2-(6-chloropyrimidin-4-yl)-1-difluoroboranyloxyethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 102231727 |
| Molecular Formula | C14H13BClF2N3O |
| Molecular Weight | 323.54 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 4-[(Z)-2-(6-chloropyrimidin-4-yl)-1-difluoroboranyloxyethenyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(/C(=C/c2cc(Cl)ncn2)OB(F)F)cc1 |
| InChI | InChI=1S/C14H13BClF2N3O/c1-21(2)12-5-3-10(4-6-12)13(22-15(17)18)7-11-8-14(16)20-9-19-11/h3-9H,1-2H3/b13-7- |
| InChIKey | GJXRAAGHJFUCPH-QPEQYQDCSA-N |
| XLogP | 3.63 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|