C18H12BClF2N2O — CID 139168209
8-chloro-2,2-difluoro-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene (PubChem CID 139168209) has the molecular formula C18H12BClF2N2O and a molecular weight of 356.57 g/mol. Its IUPAC name is 8-chloro-2,2-difluoro-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene.
| Compound Name | 8-chloro-2,2-difluoro-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 139168209 |
| Molecular Formula | C18H12BClF2N2O |
| Molecular Weight | 356.57 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 8-chloro-2,2-difluoro-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
| SMILES | F[B-]1(F)OC(c2ccccc2)=C(c2ccccc2)c2cc(Cl)nc[n+]21 |
| InChI | InChI=1S/C18H12BClF2N2O/c20-16-11-15-17(13-7-3-1-4-8-13)18(14-9-5-2-6-10-14)25-19(21,22)24(15)12-23-16/h1-12H |
| InChIKey | RQZBFDFCUPYSHC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|