C20H14B2F4N2O2 — CID 71812554
4,4,14,14-tetrafluoro-6,12-diphenyl-5,13-dioxa-1,3-diazonia-4,14-diboranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,6,8,11-pentaene (PubChem CID 71812554) has the molecular formula C20H14B2F4N2O2 and a molecular weight of 411.96 g/mol. Its IUPAC name is 4,4,14,14-tetrafluoro-6,12-diphenyl-5,13-dioxa-1,3-diazonia-4,14-diboranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,6,8,11-pentaene.
| Compound Name | 4,4,14,14-tetrafluoro-6,12-diphenyl-5,13-dioxa-1,3-diazonia-4,14-diboranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,6,8,11-pentaene |
|---|---|
| PubChem CID | 71812554 |
| Molecular Formula | C20H14B2F4N2O2 |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 4,4,14,14-tetrafluoro-6,12-diphenyl-5,13-dioxa-1,3-diazonia-4,14-diboranuidatricyclo[8.4.0.03,8]tetradeca-1(10),2,6,8,11-pentaene |
| SMILES | F[B-]1(F)OC(c2ccccc2)=Cc2cc3[n+](c[n+]21)[B-](F)(F)OC(c1ccccc1)=C3 |
| InChI | InChI=1S/C20H14B2F4N2O2/c23-21(24)27-14-28-18(11-17(27)12-19(29-21)15-7-3-1-4-8-15)13-20(30-22(28,25)26)16-9-5-2-6-10-16/h1-14H |
| InChIKey | MSBNUYXKMSCSEK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|