C30H22BF2N3O — CID 139168212
2,2-difluoro-N,N,4,5-tetraphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine (PubChem CID 139168212) has the molecular formula C30H22BF2N3O and a molecular weight of 489.33 g/mol. Its IUPAC name is 2,2-difluoro-N,N,4,5-tetraphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine.
| Compound Name | 2,2-difluoro-N,N,4,5-tetraphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine |
|---|---|
| PubChem CID | 139168212 |
| Molecular Formula | C30H22BF2N3O |
| Molecular Weight | 489.33 g/mol |
| Exact Mass | 489.18 |
| IUPAC Name | 2,2-difluoro-N,N,4,5-tetraphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine |
| SMILES | F[B-]1(F)OC(c2ccccc2)=C(c2ccccc2)c2cc(N(c3ccccc3)c3ccccc3)nc[n+]21 |
| InChI | InChI=1S/C30H22BF2N3O/c32-31(33)35-22-34-28(36(25-17-9-3-10-18-25)26-19-11-4-12-20-26)21-27(35)29(23-13-5-1-6-14-23)30(37-31)24-15-7-2-8-16-24/h1-22H |
| InChIKey | ZUFBTNKKSJSVDI-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 29.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.33 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|