C26H23BClN3O — CID 139165583
4-(8-chloro-2,2-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline (PubChem CID 139165583) has the molecular formula C26H23BClN3O and a molecular weight of 439.76 g/mol. Its IUPAC name is 4-(8-chloro-2,2-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline.
| Compound Name | 4-(8-chloro-2,2-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 139165583 |
| Molecular Formula | C26H23BClN3O |
| Molecular Weight | 439.76 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | 4-(8-chloro-2,2-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-4-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C2=Cc3cc(Cl)nc[n+]3[B-](c3ccccc3)(c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C26H23BClN3O/c1-30(2)23-15-13-20(14-16-23)25-17-24-18-26(28)29-19-31(24)27(32-25,21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-19H,1-2H3 |
| InChIKey | ABVMQRCOEBKONM-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 29.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.76 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|