C24H18BClN2O — CID 139165579
8-chloro-2,2,4-triphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene (PubChem CID 139165579) has the molecular formula C24H18BClN2O and a molecular weight of 396.69 g/mol. Its IUPAC name is 8-chloro-2,2,4-triphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene.
| Compound Name | 8-chloro-2,2,4-triphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
|---|---|
| PubChem CID | 139165579 |
| Molecular Formula | C24H18BClN2O |
| Molecular Weight | 396.69 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 8-chloro-2,2,4-triphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraene |
| SMILES | Clc1cc2[n+](cn1)[B-](c1ccccc1)(c1ccccc1)OC(c1ccccc1)=C2 |
| InChI | InChI=1S/C24H18BClN2O/c26-24-17-22-16-23(19-10-4-1-5-11-19)29-25(28(22)18-27-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-18H |
| InChIKey | PDXCGRDXBAOGFH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.69 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|