C20H18BF2N3O — CID 139168211
2,2-difluoro-N,N-dimethyl-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine (PubChem CID 139168211) has the molecular formula C20H18BF2N3O and a molecular weight of 365.19 g/mol. Its IUPAC name is 2,2-difluoro-N,N-dimethyl-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine.
| Compound Name | 2,2-difluoro-N,N-dimethyl-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine |
|---|---|
| PubChem CID | 139168211 |
| Molecular Formula | C20H18BF2N3O |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 2,2-difluoro-N,N-dimethyl-4,5-diphenyl-3-oxa-9-aza-1-azonia-2-boranuidabicyclo[4.4.0]deca-1(10),4,6,8-tetraen-8-amine |
| SMILES | CN(C)c1cc2[n+](cn1)[B-](F)(F)OC(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C20H18BF2N3O/c1-25(2)18-13-17-19(15-9-5-3-6-10-15)20(16-11-7-4-8-12-16)27-21(22,23)26(17)14-24-18/h3-14H,1-2H3 |
| InChIKey | FHHNOELVCAUSBK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|