C23H16FN4O- — CID 163686961
(Z)-[3-(2-anilinopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate (PubChem CID 163686961) has the molecular formula C23H16FN4O- and a molecular weight of 383.41 g/mol. Its IUPAC name is (Z)-[3-(2-anilinopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate.
| Compound Name | (Z)-[3-(2-anilinopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate |
|---|---|
| PubChem CID | 163686961 |
| Molecular Formula | C23H16FN4O- |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (Z)-[3-(2-anilinopyrimidin-4-yl)-6-iminocyclohexa-2,4-dien-1-ylidene]-(4-fluorophenyl)methanolate |
| SMILES | [H]/N=C1\C=CC(c2ccnc(Nc3ccccc3)n2)=C\C1=C(\[O-])c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN4O/c24-17-9-6-15(7-10-17)22(29)19-14-16(8-11-20(19)25)21-12-13-26-23(28-21)27-18-4-2-1-3-5-18/h1-14,25,29H,(H,26,27,28)/p-1/b22-19-,25-20+ |
| InChIKey | JPRJAMKCKRWKBU-NASQNBOQSA-M |
| XLogP | 4.10 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|