C20H14B2F4N2O2 — CID 177424854
[(E)-2-[6-[(Z)-2-difluoroboranyloxy-2-phenylethenyl]pyrimidin-4-yl]-1-phenylethenoxy]-difluoroborane (PubChem CID 177424854) has the molecular formula C20H14B2F4N2O2 and a molecular weight of 411.96 g/mol. Its IUPAC name is [(E)-2-[6-[(Z)-2-difluoroboranyloxy-2-phenylethenyl]pyrimidin-4-yl]-1-phenylethenoxy]-difluoroborane.
| Compound Name | [(E)-2-[6-[(Z)-2-difluoroboranyloxy-2-phenylethenyl]pyrimidin-4-yl]-1-phenylethenoxy]-difluoroborane |
|---|---|
| PubChem CID | 177424854 |
| Molecular Formula | C20H14B2F4N2O2 |
| Molecular Weight | 411.96 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [(E)-2-[6-[(Z)-2-difluoroboranyloxy-2-phenylethenyl]pyrimidin-4-yl]-1-phenylethenoxy]-difluoroborane |
| SMILES | FB(F)O/C(=C\c1cc(/C=C(/OB(F)F)c2ccccc2)ncn1)c1ccccc1 |
| InChI | InChI=1S/C20H14B2F4N2O2/c23-21(24)29-19(15-7-3-1-4-8-15)12-17-11-18(28-14-27-17)13-20(30-22(25)26)16-9-5-2-6-10-16/h1-14H/b19-12-,20-13+ |
| InChIKey | BVVQLFWMIJJAGE-ZEDXCMECSA-N |
| XLogP | 5.35 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.96 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|