C37H32Cl2N2O2 — CID 102235406
2-chloro-4-[4-[2-[4-(2-chloro-6,8-dimethylquinolin-4-yl)oxyphenyl]propan-2-yl]phenoxy]-6,8-dimethylquinoline (PubChem CID 102235406) has the molecular formula C37H32Cl2N2O2 and a molecular weight of 607.58 g/mol. Its IUPAC name is 2-chloro-4-[4-[2-[4-(2-chloro-6,8-dimethylquinolin-4-yl)oxyphenyl]propan-2-yl]phenoxy]-6,8-dimethylquinoline.
| Compound Name | 2-chloro-4-[4-[2-[4-(2-chloro-6,8-dimethylquinolin-4-yl)oxyphenyl]propan-2-yl]phenoxy]-6,8-dimethylquinoline |
|---|---|
| PubChem CID | 102235406 |
| Molecular Formula | C37H32Cl2N2O2 |
| Molecular Weight | 607.58 g/mol |
| Exact Mass | 606.18 |
| IUPAC Name | 2-chloro-4-[4-[2-[4-(2-chloro-6,8-dimethylquinolin-4-yl)oxyphenyl]propan-2-yl]phenoxy]-6,8-dimethylquinoline |
| SMILES | Cc1cc(C)c2nc(Cl)cc(Oc3ccc(C(C)(C)c4ccc(Oc5cc(Cl)nc6c(C)cc(C)cc56)cc4)cc3)c2c1 |
| InChI | InChI=1S/C37H32Cl2N2O2/c1-21-15-23(3)35-29(17-21)31(19-33(38)40-35)42-27-11-7-25(8-12-27)37(5,6)26-9-13-28(14-10-26)43-32-20-34(39)41-36-24(4)16-22(2)18-30(32)36/h7-20H,1-6H3 |
| InChIKey | IIBUPPMHFCVTRX-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.58 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|