C14H17NO2S2 — CID 102236474
butyl 2-(2-sulfanylidene-1,4-dihydro-3,1-benzothiazin-4-yl)acetate (PubChem CID 102236474) has the molecular formula C14H17NO2S2 and a molecular weight of 295.43 g/mol. Its IUPAC name is butyl 2-(2-sulfanylidene-1,4-dihydro-3,1-benzothiazin-4-yl)acetate.
| Compound Name | butyl 2-(2-sulfanylidene-1,4-dihydro-3,1-benzothiazin-4-yl)acetate |
|---|---|
| PubChem CID | 102236474 |
| Molecular Formula | C14H17NO2S2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.07 |
| IUPAC Name | butyl 2-(2-sulfanylidene-1,4-dihydro-3,1-benzothiazin-4-yl)acetate |
| SMILES | CCCCOC(=O)CC1SC(=S)Nc2ccccc21 |
| InChI | InChI=1S/C14H17NO2S2/c1-2-3-8-17-13(16)9-12-10-6-4-5-7-11(10)15-14(18)19-12/h4-7,12H,2-3,8-9H2,1H3,(H,15,18) |
| InChIKey | GUPUTZGAHRJTSK-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|