C18H26O7 — CID 102239128
methyl (1R,2S,4aS,8aR)-2-acetyloxy-5-(2-hydroxyethoxy)-1,4a-dimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalene-1-carboxylate (PubChem CID 102239128) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is methyl (1R,2S,4aS,8aR)-2-acetyloxy-5-(2-hydroxyethoxy)-1,4a-dimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1R,2S,4aS,8aR)-2-acetyloxy-5-(2-hydroxyethoxy)-1,4a-dimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 102239128 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | methyl (1R,2S,4aS,8aR)-2-acetyloxy-5-(2-hydroxyethoxy)-1,4a-dimethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalene-1-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[C@@H](OC(C)=O)CC[C@]2(C)C(OCCO)=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C18H26O7/c1-11(20)25-14-5-6-17(2)13(18(14,3)16(22)23-4)9-12(21)10-15(17)24-8-7-19/h10,13-14,19H,5-9H2,1-4H3/t13-,14+,17+,18-/m1/s1 |
| InChIKey | LKCKSSILTBOISL-IDCJVQTKSA-N |
| XLogP | 1.38 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |