C26H39NO7 — CID 163028667
methyl 2-acetyloxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 163028667) has the molecular formula C26H39NO7 and a molecular weight of 477.60 g/mol. Its IUPAC name is methyl 2-acetyloxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl 2-acetyloxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 163028667 |
| Molecular Formula | C26H39NO7 |
| Molecular Weight | 477.60 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | methyl 2-acetyloxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)C1(C)C(OC(C)=O)CCC2(C)C3CCC(=CC(=O)N(C)CCO)C(C)C3C(=O)CC21 |
| InChI | InChI=1S/C26H39NO7/c1-15-17(13-22(31)27(5)11-12-28)7-8-18-23(15)19(30)14-20-25(18,3)10-9-21(34-16(2)29)26(20,4)24(32)33-6/h13,15,18,20-21,23,28H,7-12,14H2,1-6H3 |
| InChIKey | DCLNZEMQIWSNFR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.60 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|