C23H35NO7 — CID 75291366
methyl 2,10-dihydroxy-7-[2-(2-hydroxyethylamino)-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 75291366) has the molecular formula C23H35NO7 and a molecular weight of 437.53 g/mol. Its IUPAC name is methyl 2,10-dihydroxy-7-[2-(2-hydroxyethylamino)-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl 2,10-dihydroxy-7-[2-(2-hydroxyethylamino)-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 75291366 |
| Molecular Formula | C23H35NO7 |
| Molecular Weight | 437.53 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | methyl 2,10-dihydroxy-7-[2-(2-hydroxyethylamino)-2-oxoethylidene]-1,4a,8-trimethyl-9-oxo-2,3,4,4b,5,6,8,8a,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)C1(C)C(O)CCC2(C)C3CCC(=CC(=O)NCCO)C(C)C3C(=O)C(O)C21 |
| InChI | InChI=1S/C23H35NO7/c1-12-13(11-16(27)24-9-10-25)5-6-14-17(12)18(28)19(29)20-22(14,2)8-7-15(26)23(20,3)21(30)31-4/h11-12,14-15,17,19-20,25-26,29H,5-10H2,1-4H3,(H,24,27) |
| InChIKey | AGJACTCJJUIBDI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.53 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|