C24H37NO6 — CID 162977894
methyl 9-hydroxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 162977894) has the molecular formula C24H37NO6 and a molecular weight of 435.56 g/mol. Its IUPAC name is methyl 9-hydroxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl 9-hydroxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 162977894 |
| Molecular Formula | C24H37NO6 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | methyl 9-hydroxy-7-[2-[2-hydroxyethyl(methyl)amino]-2-oxoethylidene]-1,4a,8-trimethyl-10-oxo-2,3,4,4b,5,6,8,8a,9,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)C1(C)CCCC2(C)C3CCC(=CC(=O)N(C)CCO)C(C)C3C(O)C(=O)C12 |
| InChI | InChI=1S/C24H37NO6/c1-14-15(13-17(27)25(4)11-12-26)7-8-16-18(14)19(28)20(29)21-23(16,2)9-6-10-24(21,3)22(30)31-5/h13-14,16,18-19,21,26,28H,6-12H2,1-5H3 |
| InChIKey | UDDBQHDQODRIRM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|